C14H17N3O2S2 — CID 18089744
5-acetyl-N-(5-pentyl-1,3,4-thiadiazol-2-yl)thiophene-2-carboxamide (PubChem CID 18089744) has the molecular formula C14H17N3O2S2 and a molecular weight of 323.44 g/mol. Its IUPAC name is 5-acetyl-N-(5-pentyl-1,3,4-thiadiazol-2-yl)thiophene-2-carboxamide.
| Compound Name | 5-acetyl-N-(5-pentyl-1,3,4-thiadiazol-2-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 18089744 |
| Molecular Formula | C14H17N3O2S2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 5-acetyl-N-(5-pentyl-1,3,4-thiadiazol-2-yl)thiophene-2-carboxamide |
| SMILES | CCCCCc1nnc(NC(=O)c2ccc(C(C)=O)s2)s1 |
| InChI | InChI=1S/C14H17N3O2S2/c1-3-4-5-6-12-16-17-14(21-12)15-13(19)11-8-7-10(20-11)9(2)18/h7-8H,3-6H2,1-2H3,(H,15,17,19) |
| InChIKey | AKAHLWHSXUKIFA-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|