C15H19N7O3S — CID 71909020
1-(2,2-diethoxyethyl)-N-[1-(1,3-thiazol-2-yl)pyrazol-4-yl]triazole-4-carboxamide (PubChem CID 71909020) has the molecular formula C15H19N7O3S and a molecular weight of 377.43 g/mol. Its IUPAC name is 1-(2,2-diethoxyethyl)-N-[1-(1,3-thiazol-2-yl)pyrazol-4-yl]triazole-4-carboxamide.
| Compound Name | 1-(2,2-diethoxyethyl)-N-[1-(1,3-thiazol-2-yl)pyrazol-4-yl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 71909020 |
| Molecular Formula | C15H19N7O3S |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 1-(2,2-diethoxyethyl)-N-[1-(1,3-thiazol-2-yl)pyrazol-4-yl]triazole-4-carboxamide |
| SMILES | CCOC(Cn1cc(C(=O)Nc2cnn(-c3nccs3)c2)nn1)OCC |
| InChI | InChI=1S/C15H19N7O3S/c1-3-24-13(25-4-2)10-21-9-12(19-20-21)14(23)18-11-7-17-22(8-11)15-16-5-6-26-15/h5-9,13H,3-4,10H2,1-2H3,(H,18,23) |
| InChIKey | CUJUEQBYZQWAIF-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 108.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|