C9H10N4O2S — CID 14051868
ethyl 5-amino-1-(1,3-thiazol-2-yl)pyrazole-4-carboxylate (PubChem CID 14051868) has the molecular formula C9H10N4O2S and a molecular weight of 238.27 g/mol. Its IUPAC name is ethyl 5-amino-1-(1,3-thiazol-2-yl)pyrazole-4-carboxylate.
| Compound Name | ethyl 5-amino-1-(1,3-thiazol-2-yl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 14051868 |
| Molecular Formula | C9H10N4O2S |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | ethyl 5-amino-1-(1,3-thiazol-2-yl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2nccs2)c1N |
| InChI | InChI=1S/C9H10N4O2S/c1-2-15-8(14)6-5-12-13(7(6)10)9-11-3-4-16-9/h3-5H,2,10H2,1H3 |
| InChIKey | REXGBNCZFZQRSW-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |