C12H8Cl2F3N3O2 — CID 14517405
ethyl 5-amino-1-(2,4-dichloro-3,5,6-trifluorophenyl)pyrazole-4-carboxylate (PubChem CID 14517405) has the molecular formula C12H8Cl2F3N3O2 and a molecular weight of 354.12 g/mol. Its IUPAC name is ethyl 5-amino-1-(2,4-dichloro-3,5,6-trifluorophenyl)pyrazole-4-carboxylate.
| Compound Name | ethyl 5-amino-1-(2,4-dichloro-3,5,6-trifluorophenyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 14517405 |
| Molecular Formula | C12H8Cl2F3N3O2 |
| Molecular Weight | 354.12 g/mol |
| Exact Mass | 352.99 |
| IUPAC Name | ethyl 5-amino-1-(2,4-dichloro-3,5,6-trifluorophenyl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2c(F)c(F)c(Cl)c(F)c2Cl)c1N |
| InChI | InChI=1S/C12H8Cl2F3N3O2/c1-2-22-12(21)4-3-19-20(11(4)18)10-6(14)7(15)5(13)8(16)9(10)17/h3H,2,18H2,1H3 |
| InChIKey | VHJBOEXFYXUVQU-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.12 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|