C13H6BrF7N2O2 — CID 134108717
ethyl 5-bromo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]pyrazole-4-carboxylate (PubChem CID 134108717) has the molecular formula C13H6BrF7N2O2 and a molecular weight of 435.09 g/mol. Its IUPAC name is ethyl 5-bromo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]pyrazole-4-carboxylate.
| Compound Name | ethyl 5-bromo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 134108717 |
| Molecular Formula | C13H6BrF7N2O2 |
| Molecular Weight | 435.09 g/mol |
| Exact Mass | 433.95 |
| IUPAC Name | ethyl 5-bromo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2c(F)c(F)c(C(F)(F)F)c(F)c2F)c1Br |
| InChI | InChI=1S/C13H6BrF7N2O2/c1-2-25-12(24)4-3-22-23(11(4)14)10-8(17)6(15)5(13(19,20)21)7(16)9(10)18/h3H,2H2,1H3 |
| InChIKey | LVSSQKLXIKGOBO-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.09 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|