C11H13F3N2O4 — CID 101341285
diethyl 1-amino-3-(trifluoromethyl)pyrrole-2,4-dicarboxylate (PubChem CID 101341285) has the molecular formula C11H13F3N2O4 and a molecular weight of 294.23 g/mol. Its IUPAC name is diethyl 1-amino-3-(trifluoromethyl)pyrrole-2,4-dicarboxylate.
| Compound Name | diethyl 1-amino-3-(trifluoromethyl)pyrrole-2,4-dicarboxylate |
|---|---|
| PubChem CID | 101341285 |
| Molecular Formula | C11H13F3N2O4 |
| Molecular Weight | 294.23 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | diethyl 1-amino-3-(trifluoromethyl)pyrrole-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1cn(N)c(C(=O)OCC)c1C(F)(F)F |
| InChI | InChI=1S/C11H13F3N2O4/c1-3-19-9(17)6-5-16(15)8(10(18)20-4-2)7(6)11(12,13)14/h5H,3-4,15H2,1-2H3 |
| InChIKey | DYSLBBMYDYOBOM-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.23 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |