C14H13F3N2O2S — CID 146285518
ethyl 1-(2-methylsulfanylphenyl)-5-(trifluoromethyl)pyrazole-4-carboxylate (PubChem CID 146285518) has the molecular formula C14H13F3N2O2S and a molecular weight of 330.33 g/mol. Its IUPAC name is ethyl 1-(2-methylsulfanylphenyl)-5-(trifluoromethyl)pyrazole-4-carboxylate.
| Compound Name | ethyl 1-(2-methylsulfanylphenyl)-5-(trifluoromethyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 146285518 |
| Molecular Formula | C14H13F3N2O2S |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | ethyl 1-(2-methylsulfanylphenyl)-5-(trifluoromethyl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2ccccc2SC)c1C(F)(F)F |
| InChI | InChI=1S/C14H13F3N2O2S/c1-3-21-13(20)9-8-18-19(12(9)14(15,16)17)10-6-4-5-7-11(10)22-2/h4-8H,3H2,1-2H3 |
| InChIKey | FNJMOAPOAVGNBQ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |