C12H10F3N3OS — CID 175836222
1-(2-methylsulfanylphenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 175836222) has the molecular formula C12H10F3N3OS and a molecular weight of 301.29 g/mol. Its IUPAC name is 1-(2-methylsulfanylphenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | 1-(2-methylsulfanylphenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 175836222 |
| Molecular Formula | C12H10F3N3OS |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 1-(2-methylsulfanylphenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | CSc1ccccc1-n1ncc(C(N)=O)c1C(F)(F)F |
| InChI | InChI=1S/C12H10F3N3OS/c1-20-9-5-3-2-4-8(9)18-10(12(13,14)15)7(6-17-18)11(16)19/h2-6H,1H3,(H2,16,19) |
| InChIKey | MVGRMLVRILWUBS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |