C13H11ClF3N3O2 — CID 146285563
ethyl 1-(2-chloro-3-methyl-4-pyridinyl)-5-(trifluoromethyl)pyrazole-4-carboxylate (PubChem CID 146285563) has the molecular formula C13H11ClF3N3O2 and a molecular weight of 333.70 g/mol. Its IUPAC name is ethyl 1-(2-chloro-3-methyl-4-pyridinyl)-5-(trifluoromethyl)pyrazole-4-carboxylate.
| Compound Name | ethyl 1-(2-chloro-3-methyl-4-pyridinyl)-5-(trifluoromethyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 146285563 |
| Molecular Formula | C13H11ClF3N3O2 |
| Molecular Weight | 333.70 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | ethyl 1-(2-chloro-3-methyl-4-pyridinyl)-5-(trifluoromethyl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2ccnc(Cl)c2C)c1C(F)(F)F |
| InChI | InChI=1S/C13H11ClF3N3O2/c1-3-22-12(21)8-6-19-20(10(8)13(15,16)17)9-4-5-18-11(14)7(9)2/h4-6H,3H2,1-2H3 |
| InChIKey | BZNSPGKVFMFQDR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.70 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|