C12H17F3N2O2 — CID 63235497
ethyl 1-pentan-3-yl-5-(trifluoromethyl)pyrazole-4-carboxylate (PubChem CID 63235497) has the molecular formula C12H17F3N2O2 and a molecular weight of 278.27 g/mol. Its IUPAC name is ethyl 1-pentan-3-yl-5-(trifluoromethyl)pyrazole-4-carboxylate.
| Compound Name | ethyl 1-pentan-3-yl-5-(trifluoromethyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 63235497 |
| Molecular Formula | C12H17F3N2O2 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | ethyl 1-pentan-3-yl-5-(trifluoromethyl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(C(CC)CC)c1C(F)(F)F |
| InChI | InChI=1S/C12H17F3N2O2/c1-4-8(5-2)17-10(12(13,14)15)9(7-16-17)11(18)19-6-3/h7-8H,4-6H2,1-3H3 |
| InChIKey | AMMHVAZHAJGFLK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |