C12H17F3N2O5 — CID 169239059
ethyl 5-(trifluoromethyl)-1-(1,1,3-trihydroxy-3-methylbutyl)pyrazole-4-carboxylate (PubChem CID 169239059) has the molecular formula C12H17F3N2O5 and a molecular weight of 326.27 g/mol. Its IUPAC name is ethyl 5-(trifluoromethyl)-1-(1,1,3-trihydroxy-3-methylbutyl)pyrazole-4-carboxylate.
| Compound Name | ethyl 5-(trifluoromethyl)-1-(1,1,3-trihydroxy-3-methylbutyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 169239059 |
| Molecular Formula | C12H17F3N2O5 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | ethyl 5-(trifluoromethyl)-1-(1,1,3-trihydroxy-3-methylbutyl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(C(O)(O)CC(C)(C)O)c1C(F)(F)F |
| InChI | InChI=1S/C12H17F3N2O5/c1-4-22-9(18)7-5-16-17(8(7)12(13,14)15)11(20,21)6-10(2,3)19/h5,19-21H,4,6H2,1-3H3 |
| InChIKey | ZDBKQKARHODWNV-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|