C19H35F3N4O4 — CID 157283477
ethyl 1-[2-[(2-methylpropan-2-yl)oxy]ethyl]-5-(trifluoromethyl)pyrazole-4-carboxylate;2-[(2-methylpropan-2-yl)oxy]ethylhydrazine (PubChem CID 157283477) has the molecular formula C19H35F3N4O4 and a molecular weight of 440.51 g/mol. Its IUPAC name is ethyl 1-[2-[(2-methylpropan-2-yl)oxy]ethyl]-5-(trifluoromethyl)pyrazole-4-carboxylate;2-[(2-methylpropan-2-yl)oxy]ethylhydrazine.
| Compound Name | ethyl 1-[2-[(2-methylpropan-2-yl)oxy]ethyl]-5-(trifluoromethyl)pyrazole-4-carboxylate;2-[(2-methylpropan-2-yl)oxy]ethylhydrazine |
|---|---|
| PubChem CID | 157283477 |
| Molecular Formula | C19H35F3N4O4 |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | ethyl 1-[2-[(2-methylpropan-2-yl)oxy]ethyl]-5-(trifluoromethyl)pyrazole-4-carboxylate;2-[(2-methylpropan-2-yl)oxy]ethylhydrazine |
| SMILES | CC(C)(C)OCCNN.CCOC(=O)c1cnn(CCOC(C)(C)C)c1C(F)(F)F |
| InChI | InChI=1S/C13H19F3N2O3.C6H16N2O/c1-5-20-11(19)9-8-17-18(10(9)13(14,15)16)6-7-21-12(2,3)4;1-6(2,3)9-5-4-8-7/h8H,5-7H2,1-4H3;8H,4-5,7H2,1-3H3 |
| InChIKey | AZYHXDDQSUVFCB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|