C12H18F3N3O3 — CID 116631192
ethyl 1-methyl-5-[[2-(2,2,2-trifluoroethoxy)ethylamino]methyl]pyrazole-4-carboxylate (PubChem CID 116631192) has the molecular formula C12H18F3N3O3 and a molecular weight of 309.29 g/mol. Its IUPAC name is ethyl 1-methyl-5-[[2-(2,2,2-trifluoroethoxy)ethylamino]methyl]pyrazole-4-carboxylate.
| Compound Name | ethyl 1-methyl-5-[[2-(2,2,2-trifluoroethoxy)ethylamino]methyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 116631192 |
| Molecular Formula | C12H18F3N3O3 |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | ethyl 1-methyl-5-[[2-(2,2,2-trifluoroethoxy)ethylamino]methyl]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(C)c1CNCCOCC(F)(F)F |
| InChI | InChI=1S/C12H18F3N3O3/c1-3-21-11(19)9-6-17-18(2)10(9)7-16-4-5-20-8-12(13,14)15/h6,16H,3-5,7-8H2,1-2H3 |
| InChIKey | BQNMCLFXDMCKCU-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|