C11H13F5N2O3 — CID 116629808
ethyl 1-methyl-5-(2,2,3,3,3-pentafluoropropoxymethyl)pyrazole-4-carboxylate (PubChem CID 116629808) has the molecular formula C11H13F5N2O3 and a molecular weight of 316.23 g/mol. Its IUPAC name is ethyl 1-methyl-5-(2,2,3,3,3-pentafluoropropoxymethyl)pyrazole-4-carboxylate.
| Compound Name | ethyl 1-methyl-5-(2,2,3,3,3-pentafluoropropoxymethyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 116629808 |
| Molecular Formula | C11H13F5N2O3 |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | ethyl 1-methyl-5-(2,2,3,3,3-pentafluoropropoxymethyl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(C)c1COCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H13F5N2O3/c1-3-21-9(19)7-4-17-18(2)8(7)5-20-6-10(12,13)11(14,15)16/h4H,3,5-6H2,1-2H3 |
| InChIKey | KYBQVHFEBHLOFU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|