C15H27N3O3 — CID 106256100
ethyl 5-[[[2-ethyl-2-(hydroxymethyl)butyl]amino]methyl]-1-methylpyrazole-4-carboxylate (PubChem CID 106256100) has the molecular formula C15H27N3O3 and a molecular weight of 297.40 g/mol. Its IUPAC name is ethyl 5-[[[2-ethyl-2-(hydroxymethyl)butyl]amino]methyl]-1-methylpyrazole-4-carboxylate.
| Compound Name | ethyl 5-[[[2-ethyl-2-(hydroxymethyl)butyl]amino]methyl]-1-methylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 106256100 |
| Molecular Formula | C15H27N3O3 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | ethyl 5-[[[2-ethyl-2-(hydroxymethyl)butyl]amino]methyl]-1-methylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(C)c1CNCC(CC)(CC)CO |
| InChI | InChI=1S/C15H27N3O3/c1-5-15(6-2,11-19)10-16-9-13-12(8-17-18(13)4)14(20)21-7-3/h8,16,19H,5-7,9-11H2,1-4H3 |
| InChIKey | NTTGPUBQTANGGC-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |