C16H29N3O2 — CID 116631446
ethyl 1-methyl-5-[(octylamino)methyl]pyrazole-4-carboxylate (PubChem CID 116631446) has the molecular formula C16H29N3O2 and a molecular weight of 295.43 g/mol. Its IUPAC name is ethyl 1-methyl-5-[(octylamino)methyl]pyrazole-4-carboxylate.
| Compound Name | ethyl 1-methyl-5-[(octylamino)methyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 116631446 |
| Molecular Formula | C16H29N3O2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | ethyl 1-methyl-5-[(octylamino)methyl]pyrazole-4-carboxylate |
| SMILES | CCCCCCCCNCc1c(C(=O)OCC)cnn1C |
| InChI | InChI=1S/C16H29N3O2/c1-4-6-7-8-9-10-11-17-13-15-14(12-18-19(15)3)16(20)21-5-2/h12,17H,4-11,13H2,1-3H3 |
| InChIKey | LAFBVLUJXKHOPW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|