C23H19F3N4O5 — CID 150578600
3-(1-benzyltriazol-4-yl)-2-[cyclopropyl-[4-(trifluoromethoxy)benzoyl]amino]-3-oxopropanoic acid (PubChem CID 150578600) has the molecular formula C23H19F3N4O5 and a molecular weight of 488.42 g/mol. Its IUPAC name is 3-(1-benzyltriazol-4-yl)-2-[cyclopropyl-[4-(trifluoromethoxy)benzoyl]amino]-3-oxopropanoic acid.
| Compound Name | 3-(1-benzyltriazol-4-yl)-2-[cyclopropyl-[4-(trifluoromethoxy)benzoyl]amino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 150578600 |
| Molecular Formula | C23H19F3N4O5 |
| Molecular Weight | 488.42 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | 3-(1-benzyltriazol-4-yl)-2-[cyclopropyl-[4-(trifluoromethoxy)benzoyl]amino]-3-oxopropanoic acid |
| SMILES | O=C(O)C(C(=O)c1cn(Cc2ccccc2)nn1)N(C(=O)c1ccc(OC(F)(F)F)cc1)C1CC1 |
| InChI | InChI=1S/C23H19F3N4O5/c24-23(25,26)35-17-10-6-15(7-11-17)21(32)30(16-8-9-16)19(22(33)34)20(31)18-13-29(28-27-18)12-14-4-2-1-3-5-14/h1-7,10-11,13,16,19H,8-9,12H2,(H,33,34) |
| InChIKey | INISVJVAUKJMOF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|