C21H20F3N3O5S — CID 67133087
ethyl 2-[cyclopropyl-[4-(trifluoromethoxy)benzoyl]amino]-3-(2-methylsulfanylpyrimidin-5-yl)-3-oxopropanoate (PubChem CID 67133087) has the molecular formula C21H20F3N3O5S and a molecular weight of 483.47 g/mol. Its IUPAC name is ethyl 2-[cyclopropyl-[4-(trifluoromethoxy)benzoyl]amino]-3-(2-methylsulfanylpyrimidin-5-yl)-3-oxopropanoate.
| Compound Name | ethyl 2-[cyclopropyl-[4-(trifluoromethoxy)benzoyl]amino]-3-(2-methylsulfanylpyrimidin-5-yl)-3-oxopropanoate |
|---|---|
| PubChem CID | 67133087 |
| Molecular Formula | C21H20F3N3O5S |
| Molecular Weight | 483.47 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | ethyl 2-[cyclopropyl-[4-(trifluoromethoxy)benzoyl]amino]-3-(2-methylsulfanylpyrimidin-5-yl)-3-oxopropanoate |
| SMILES | CCOC(=O)C(C(=O)c1cnc(SC)nc1)N(C(=O)c1ccc(OC(F)(F)F)cc1)C1CC1 |
| InChI | InChI=1S/C21H20F3N3O5S/c1-3-31-19(30)16(17(28)13-10-25-20(33-2)26-11-13)27(14-6-7-14)18(29)12-4-8-15(9-5-12)32-21(22,23)24/h4-5,8-11,14,16H,3,6-7H2,1-2H3 |
| InChIKey | BPOYMMDXHNZWHA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 98.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|