C13H11F3N2O2 — CID 51093391
N-(cyanomethyl)-N-cyclopropyl-4-(trifluoromethoxy)benzamide (PubChem CID 51093391) has the molecular formula C13H11F3N2O2 and a molecular weight of 284.24 g/mol. Its IUPAC name is N-(cyanomethyl)-N-cyclopropyl-4-(trifluoromethoxy)benzamide.
| Compound Name | N-(cyanomethyl)-N-cyclopropyl-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 51093391 |
| Molecular Formula | C13H11F3N2O2 |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | N-(cyanomethyl)-N-cyclopropyl-4-(trifluoromethoxy)benzamide |
| SMILES | N#CCN(C(=O)c1ccc(OC(F)(F)F)cc1)C1CC1 |
| InChI | InChI=1S/C13H11F3N2O2/c14-13(15,16)20-11-5-1-9(2-6-11)12(19)18(8-7-17)10-3-4-10/h1-2,5-6,10H,3-4,8H2 |
| InChIKey | MXHITFPERWNTAA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|