C18H24N4O — CID 134020397
1-benzyl-N-methyl-N-(2-methylcyclohexyl)triazole-4-carboxamide (PubChem CID 134020397) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is 1-benzyl-N-methyl-N-(2-methylcyclohexyl)triazole-4-carboxamide.
| Compound Name | 1-benzyl-N-methyl-N-(2-methylcyclohexyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 134020397 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 1-benzyl-N-methyl-N-(2-methylcyclohexyl)triazole-4-carboxamide |
| SMILES | CC1CCCCC1N(C)C(=O)c1cn(Cc2ccccc2)nn1 |
| InChI | InChI=1S/C18H24N4O/c1-14-8-6-7-11-17(14)21(2)18(23)16-13-22(20-19-16)12-15-9-4-3-5-10-15/h3-5,9-10,13-14,17H,6-8,11-12H2,1-2H3 |
| InChIKey | PFTYQEYUTJYZKD-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |