C28H32FN3O — CID 166629220
4-[[4-[(1E,3S)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenoxy]methyl]-1-[(4-fluorophenyl)methyl]triazole (PubChem CID 166629220) has the molecular formula C28H32FN3O and a molecular weight of 445.58 g/mol. Its IUPAC name is 4-[[4-[(1E,3S)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenoxy]methyl]-1-[(4-fluorophenyl)methyl]triazole.
| Compound Name | 4-[[4-[(1E,3S)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenoxy]methyl]-1-[(4-fluorophenyl)methyl]triazole |
|---|---|
| PubChem CID | 166629220 |
| Molecular Formula | C28H32FN3O |
| Molecular Weight | 445.58 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | 4-[[4-[(1E,3S)-3-ethenyl-3,7-dimethylocta-1,6-dienyl]phenoxy]methyl]-1-[(4-fluorophenyl)methyl]triazole |
| SMILES | C=C[C@@](C)(/C=C/c1ccc(OCc2cn(Cc3ccc(F)cc3)nn2)cc1)CCC=C(C)C |
| InChI | InChI=1S/C28H32FN3O/c1-5-28(4,17-6-7-22(2)3)18-16-23-10-14-27(15-11-23)33-21-26-20-32(31-30-26)19-24-8-12-25(29)13-9-24/h5,7-16,18,20H,1,6,17,19,21H2,2-4H3/b18-16+/t28-/m1/s1 |
| InChIKey | JQGXJCHPQSKIGO-AHSQRVJLSA-N |
| XLogP | 7.00 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.58 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|