C25H20FN3O5 — CID 162675323
3-[(E)-3-[4-[[1-[(2-fluorophenyl)methyl]triazol-4-yl]methoxy]phenyl]prop-2-enoyl]-4-hydroxy-6-methylpyran-2-one (PubChem CID 162675323) has the molecular formula C25H20FN3O5 and a molecular weight of 461.45 g/mol. Its IUPAC name is 3-[(E)-3-[4-[[1-[(2-fluorophenyl)methyl]triazol-4-yl]methoxy]phenyl]prop-2-enoyl]-4-hydroxy-6-methylpyran-2-one.
| Compound Name | 3-[(E)-3-[4-[[1-[(2-fluorophenyl)methyl]triazol-4-yl]methoxy]phenyl]prop-2-enoyl]-4-hydroxy-6-methylpyran-2-one |
|---|---|
| PubChem CID | 162675323 |
| Molecular Formula | C25H20FN3O5 |
| Molecular Weight | 461.45 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | 3-[(E)-3-[4-[[1-[(2-fluorophenyl)methyl]triazol-4-yl]methoxy]phenyl]prop-2-enoyl]-4-hydroxy-6-methylpyran-2-one |
| SMILES | Cc1cc(O)c(C(=O)/C=C/c2ccc(OCc3cn(Cc4ccccc4F)nn3)cc2)c(=O)o1 |
| InChI | InChI=1S/C25H20FN3O5/c1-16-12-23(31)24(25(32)34-16)22(30)11-8-17-6-9-20(10-7-17)33-15-19-14-29(28-27-19)13-18-4-2-3-5-21(18)26/h2-12,14,31H,13,15H2,1H3/b11-8+ |
| InChIKey | UNMSUATWQLWPGE-DHZHZOJOSA-N |
| XLogP | 3.91 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|