C25H21FO2 — CID 22026869
(E)-1-(4-fluorophenyl)-3-[4-[(4-prop-1-en-2-ylphenyl)methoxy]phenyl]prop-2-en-1-one (PubChem CID 22026869) has the molecular formula C25H21FO2 and a molecular weight of 372.44 g/mol. Its IUPAC name is (E)-1-(4-fluorophenyl)-3-[4-[(4-prop-1-en-2-ylphenyl)methoxy]phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-fluorophenyl)-3-[4-[(4-prop-1-en-2-ylphenyl)methoxy]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 22026869 |
| Molecular Formula | C25H21FO2 |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | (E)-1-(4-fluorophenyl)-3-[4-[(4-prop-1-en-2-ylphenyl)methoxy]phenyl]prop-2-en-1-one |
| SMILES | C=C(C)c1ccc(COc2ccc(/C=C/C(=O)c3ccc(F)cc3)cc2)cc1 |
| InChI | InChI=1S/C25H21FO2/c1-18(2)21-8-3-20(4-9-21)17-28-24-14-5-19(6-15-24)7-16-25(27)22-10-12-23(26)13-11-22/h3-16H,1,17H2,2H3/b16-7+ |
| InChIKey | BGRVOJQHHXIBRC-FRKPEAEDSA-N |
| XLogP | 6.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|