C20H23N3 — CID 112717972
1-benzyl-4-[2-(3,4-dimethylphenyl)propyl]triazole (PubChem CID 112717972) has the molecular formula C20H23N3 and a molecular weight of 305.43 g/mol. Its IUPAC name is 1-benzyl-4-[2-(3,4-dimethylphenyl)propyl]triazole.
| Compound Name | 1-benzyl-4-[2-(3,4-dimethylphenyl)propyl]triazole |
|---|---|
| PubChem CID | 112717972 |
| Molecular Formula | C20H23N3 |
| Molecular Weight | 305.43 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | 1-benzyl-4-[2-(3,4-dimethylphenyl)propyl]triazole |
| SMILES | Cc1ccc(C(C)Cc2cn(Cc3ccccc3)nn2)cc1C |
| InChI | InChI=1S/C20H23N3/c1-15-9-10-19(11-16(15)2)17(3)12-20-14-23(22-21-20)13-18-7-5-4-6-8-18/h4-11,14,17H,12-13H2,1-3H3 |
| InChIKey | AVGGRAGELZJOAT-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.43 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |