C15H22O3 — CID 78155540
4,4a-dihydroxy-3,6,6,7b-tetramethyl-4,5,7,7a-tetrahydro-1H-cyclobuta[e]inden-2-one (PubChem CID 78155540) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is 4,4a-dihydroxy-3,6,6,7b-tetramethyl-4,5,7,7a-tetrahydro-1H-cyclobuta[e]inden-2-one.
| Compound Name | 4,4a-dihydroxy-3,6,6,7b-tetramethyl-4,5,7,7a-tetrahydro-1H-cyclobuta[e]inden-2-one |
|---|---|
| PubChem CID | 78155540 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 4,4a-dihydroxy-3,6,6,7b-tetramethyl-4,5,7,7a-tetrahydro-1H-cyclobuta[e]inden-2-one |
| SMILES | CC1=C2C(=O)CC2(C)C2CC(C)(C)CC2(O)C1O |
| InChI | InChI=1S/C15H22O3/c1-8-11-9(16)5-14(11,4)10-6-13(2,3)7-15(10,18)12(8)17/h10,12,17-18H,5-7H2,1-4H3 |
| InChIKey | RRRONDJVEDNVCQ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |