About 6,6-dimethylcyclohept-2-ene-1,4-dione
6,6-dimethylcyclohept-2-ene-1,4-dione (PubChem CID 70336025) has the molecular formula C9H12O2
and a molecular weight of 152.19 g/mol. Its IUPAC name is 6,6-dimethylcyclohept-2-ene-1,4-dione.
Molecular Properties
| Compound Name | 6,6-dimethylcyclohept-2-ene-1,4-dione |
| PubChem CID | 70336025 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 6,6-dimethylcyclohept-2-ene-1,4-dione |
| SMILES | CC1(C)CC(=O)C=CC(=O)C1 |
| InChI | InChI=1S/C9H12O2/c1-9(2)5-7(10)3-4-8(11)6-9/h3-4H,5-6H2,1-2H3 |
| InChIKey | DZWZFTXFOLBOAP-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,6-dimethylcyclohept-2-ene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dimethylcyclohept-2-ene-1,4-dione?
The IUPAC name of 6,6-dimethylcyclohept-2-ene-1,4-dione (CID 70336025) is 6,6-dimethylcyclohept-2-ene-1,4-dione.
What is the SMILES notation for 6,6-dimethylcyclohept-2-ene-1,4-dione?
The canonical SMILES for 6,6-dimethylcyclohept-2-ene-1,4-dione is CC1(C)CC(=O)C=CC(=O)C1.
What is the InChIKey of 6,6-dimethylcyclohept-2-ene-1,4-dione?
The InChIKey is DZWZFTXFOLBOAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O2/c1-9(2)5-7(10)3-4-8(11)6-9/h3-4H,5-6H2,1-2H3.
What are the key properties of 6,6-dimethylcyclohept-2-ene-1,4-dione?
6,6-dimethylcyclohept-2-ene-1,4-dione has a molecular weight of 152.19 g/mol, XLogP of 1.50, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dimethylcyclohept-2-ene-1,4-dione is sourced from PubChem (CID 70336025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).