C9H12O2 — CID 70336025
6,6-dimethylcyclohept-2-ene-1,4-dione (PubChem CID 70336025) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is 6,6-dimethylcyclohept-2-ene-1,4-dione.
| Compound Name | 6,6-dimethylcyclohept-2-ene-1,4-dione |
|---|---|
| PubChem CID | 70336025 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 6,6-dimethylcyclohept-2-ene-1,4-dione |
| SMILES | CC1(C)CC(=O)C=CC(=O)C1 |
| InChI | InChI=1S/C9H12O2/c1-9(2)5-7(10)3-4-8(11)6-9/h3-4H,5-6H2,1-2H3 |
| InChIKey | DZWZFTXFOLBOAP-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |