C12H18O2 — CID 174494735
5,5-di(propan-2-yl)cyclohex-2-ene-1,4-dione (PubChem CID 174494735) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 5,5-di(propan-2-yl)cyclohex-2-ene-1,4-dione.
| Compound Name | 5,5-di(propan-2-yl)cyclohex-2-ene-1,4-dione |
|---|---|
| PubChem CID | 174494735 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 5,5-di(propan-2-yl)cyclohex-2-ene-1,4-dione |
| SMILES | CC(C)C1(C(C)C)CC(=O)C=CC1=O |
| InChI | InChI=1S/C12H18O2/c1-8(2)12(9(3)4)7-10(13)5-6-11(12)14/h5-6,8-9H,7H2,1-4H3 |
| InChIKey | PHXFUKVJJHBGGA-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |