C6H4Cl2O2 — CID 57145683
5,5-dichlorocyclohex-2-ene-1,4-dione (PubChem CID 57145683) has the molecular formula C6H4Cl2O2 and a molecular weight of 179.00 g/mol. Its IUPAC name is 5,5-dichlorocyclohex-2-ene-1,4-dione.
| Compound Name | 5,5-dichlorocyclohex-2-ene-1,4-dione |
|---|---|
| PubChem CID | 57145683 |
| Molecular Formula | C6H4Cl2O2 |
| Molecular Weight | 179.00 g/mol |
| Exact Mass | 177.96 |
| IUPAC Name | 5,5-dichlorocyclohex-2-ene-1,4-dione |
| SMILES | O=C1C=CC(=O)C(Cl)(Cl)C1 |
| InChI | InChI=1S/C6H4Cl2O2/c7-6(8)3-4(9)1-2-5(6)10/h1-2H,3H2 |
| InChIKey | SZRJVABHAGTXCH-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.00 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|