About spiro[4.5]dec-3-en-2-one;hydrochloride
spiro[4.5]dec-3-en-2-one;hydrochloride (PubChem CID 20548247) has the molecular formula C10H15ClO
and a molecular weight of 186.68 g/mol. Its IUPAC name is spiro[4.5]dec-3-en-2-one;hydrochloride.
Molecular Properties
| Compound Name | spiro[4.5]dec-3-en-2-one;hydrochloride |
| PubChem CID | 20548247 |
| Molecular Formula | C10H15ClO |
| Molecular Weight | 186.68 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | spiro[4.5]dec-3-en-2-one;hydrochloride |
| SMILES | Cl.O=C1C=CC2(CCCCC2)C1 |
| InChI | InChI=1S/C10H14O.ClH/c11-9-4-7-10(8-9)5-2-1-3-6-10;/h4,7H,1-3,5-6,8H2;1H |
| InChIKey | LGNZTWLGBDOFCX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.68 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze spiro[4.5]dec-3-en-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[4.5]dec-3-en-2-one;hydrochloride?
The IUPAC name of spiro[4.5]dec-3-en-2-one;hydrochloride (CID 20548247) is spiro[4.5]dec-3-en-2-one;hydrochloride.
What is the SMILES notation for spiro[4.5]dec-3-en-2-one;hydrochloride?
The canonical SMILES for spiro[4.5]dec-3-en-2-one;hydrochloride is Cl.O=C1C=CC2(CCCCC2)C1.
What is the InChIKey of spiro[4.5]dec-3-en-2-one;hydrochloride?
The InChIKey is LGNZTWLGBDOFCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O.ClH/c11-9-4-7-10(8-9)5-2-1-3-6-10;/h4,7H,1-3,5-6,8H2;1H.
What are the key properties of spiro[4.5]dec-3-en-2-one;hydrochloride?
spiro[4.5]dec-3-en-2-one;hydrochloride has a molecular weight of 186.68 g/mol, XLogP of 2.89, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[4.5]dec-3-en-2-one;hydrochloride is sourced from PubChem (CID 20548247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).