C10H12O2 — CID 102029700
1-oxaspiro[5.5]undeca-2,10-dien-4-one (PubChem CID 102029700) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is 1-oxaspiro[5.5]undeca-2,10-dien-4-one.
| Compound Name | 1-oxaspiro[5.5]undeca-2,10-dien-4-one |
|---|---|
| PubChem CID | 102029700 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 1-oxaspiro[5.5]undeca-2,10-dien-4-one |
| SMILES | O=C1C=COC2(C=CCCC2)C1 |
| InChI | InChI=1S/C10H12O2/c11-9-4-7-12-10(8-9)5-2-1-3-6-10/h2,4-5,7H,1,3,6,8H2 |
| InChIKey | JWNPBHBQNOBATJ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|