C12H12O4 — CID 134856266
7,13-dioxadispiro[4.0.56.35]tetradeca-2,8-diene-10,14-dione (PubChem CID 134856266) has the molecular formula C12H12O4 and a molecular weight of 220.22 g/mol. Its IUPAC name is 7,13-dioxadispiro[4.0.56.35]tetradeca-2,8-diene-10,14-dione.
| Compound Name | 7,13-dioxadispiro[4.0.56.35]tetradeca-2,8-diene-10,14-dione |
|---|---|
| PubChem CID | 134856266 |
| Molecular Formula | C12H12O4 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 7,13-dioxadispiro[4.0.56.35]tetradeca-2,8-diene-10,14-dione |
| SMILES | O=C1C=COC2(COC(=O)C23CC=CC3)C1 |
| InChI | InChI=1S/C12H12O4/c13-9-3-6-16-12(7-9)8-15-10(14)11(12)4-1-2-5-11/h1-3,6H,4-5,7-8H2 |
| InChIKey | UGDUSBQNRXVTMZ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|