C14H14O3 — CID 104524767
3-methylspiro[2,3-dihydrochromene-4,2'-3H-pyran]-4'-one (PubChem CID 104524767) has the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. Its IUPAC name is 3-methylspiro[2,3-dihydrochromene-4,2'-3H-pyran]-4'-one.
| Compound Name | 3-methylspiro[2,3-dihydrochromene-4,2'-3H-pyran]-4'-one |
|---|---|
| PubChem CID | 104524767 |
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 3-methylspiro[2,3-dihydrochromene-4,2'-3H-pyran]-4'-one |
| SMILES | CC1COc2ccccc2C12CC(=O)C=CO2 |
| InChI | InChI=1S/C14H14O3/c1-10-9-16-13-5-3-2-4-12(13)14(10)8-11(15)6-7-17-14/h2-7,10H,8-9H2,1H3 |
| InChIKey | MROIGAFJDLHBMH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |