About 3-methyl-N-propylspiro[2,3-dihydrochromene-4,2'-oxane]-4'-amine
3-methyl-N-propylspiro[2,3-dihydrochromene-4,2'-oxane]-4'-amine (PubChem CID 104524773) has the molecular formula C17H25NO2
and a molecular weight of 275.39 g/mol. Its IUPAC name is 3-methyl-N-propylspiro[2,3-dihydrochromene-4,2'-oxane]-4'-amine.
Molecular Properties
| Compound Name | 3-methyl-N-propylspiro[2,3-dihydrochromene-4,2'-oxane]-4'-amine |
| PubChem CID | 104524773 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 3-methyl-N-propylspiro[2,3-dihydrochromene-4,2'-oxane]-4'-amine |
| SMILES | CCCNC1CCOC2(C1)c1ccccc1OCC2C |
| InChI | InChI=1S/C17H25NO2/c1-3-9-18-14-8-10-20-17(11-14)13(2)12-19-16-7-5-4-6-15(16)17/h4-7,13-14,18H,3,8-12H2,1-2H3 |
| InChIKey | QCGBLSVGBDSBEX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methyl-N-propylspiro[2,3-dihydrochromene-4,2'-oxane]-4'-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-N-propylspiro[2,3-dihydrochromene-4,2'-oxane]-4'-amine?
The IUPAC name of 3-methyl-N-propylspiro[2,3-dihydrochromene-4,2'-oxane]-4'-amine (CID 104524773) is 3-methyl-N-propylspiro[2,3-dihydrochromene-4,2'-oxane]-4'-amine.
What is the SMILES notation for 3-methyl-N-propylspiro[2,3-dihydrochromene-4,2'-oxane]-4'-amine?
The canonical SMILES for 3-methyl-N-propylspiro[2,3-dihydrochromene-4,2'-oxane]-4'-amine is CCCNC1CCOC2(C1)c1ccccc1OCC2C.
What is the InChIKey of 3-methyl-N-propylspiro[2,3-dihydrochromene-4,2'-oxane]-4'-amine?
The InChIKey is QCGBLSVGBDSBEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NO2/c1-3-9-18-14-8-10-20-17(11-14)13(2)12-19-16-7-5-4-6-15(16)17/h4-7,13-14,18H,3,8-12H2,1-2H3.
What are the key properties of 3-methyl-N-propylspiro[2,3-dihydrochromene-4,2'-oxane]-4'-amine?
3-methyl-N-propylspiro[2,3-dihydrochromene-4,2'-oxane]-4'-amine has a molecular weight of 275.39 g/mol, XLogP of 3.09, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-N-propylspiro[2,3-dihydrochromene-4,2'-oxane]-4'-amine is sourced from PubChem (CID 104524773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).