C11H16 — CID 123168387
8-methylspiro[4.5]deca-7,9-diene (PubChem CID 123168387) has the molecular formula C11H16 and a molecular weight of 148.25 g/mol. Its IUPAC name is 8-methylspiro[4.5]deca-7,9-diene.
| Compound Name | 8-methylspiro[4.5]deca-7,9-diene |
|---|---|
| PubChem CID | 123168387 |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | 8-methylspiro[4.5]deca-7,9-diene |
| SMILES | CC1=CCC2(C=C1)CCCC2 |
| InChI | InChI=1S/C11H16/c1-10-4-8-11(9-5-10)6-2-3-7-11/h4-5,8H,2-3,6-7,9H2,1H3 |
| InChIKey | NHDJNOIQHWPGMQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |