C13H20O3S — CID 176894654
1-cyclohexylsulfonyl-4-methylcyclohexa-2,4-dien-1-ol (PubChem CID 176894654) has the molecular formula C13H20O3S and a molecular weight of 256.37 g/mol. Its IUPAC name is 1-cyclohexylsulfonyl-4-methylcyclohexa-2,4-dien-1-ol.
| Compound Name | 1-cyclohexylsulfonyl-4-methylcyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 176894654 |
| Molecular Formula | C13H20O3S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 1-cyclohexylsulfonyl-4-methylcyclohexa-2,4-dien-1-ol |
| SMILES | CC1=CCC(O)(S(=O)(=O)C2CCCCC2)C=C1 |
| InChI | InChI=1S/C13H20O3S/c1-11-7-9-13(14,10-8-11)17(15,16)12-5-3-2-4-6-12/h7-9,12,14H,2-6,10H2,1H3 |
| InChIKey | MEWBNSNKBSQDML-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |