About 1-cyclohexylsulfonyl-4-methylcyclohexa-2,4-dien-1-ol
1-cyclohexylsulfonyl-4-methylcyclohexa-2,4-dien-1-ol (PubChem CID 176894654) has the molecular formula C13H20O3S
and a molecular weight of 256.37 g/mol. Its IUPAC name is 1-cyclohexylsulfonyl-4-methylcyclohexa-2,4-dien-1-ol.
Molecular Properties
| Compound Name | 1-cyclohexylsulfonyl-4-methylcyclohexa-2,4-dien-1-ol |
| PubChem CID | 176894654 |
| Molecular Formula | C13H20O3S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 1-cyclohexylsulfonyl-4-methylcyclohexa-2,4-dien-1-ol |
| SMILES | CC1=CCC(O)(S(=O)(=O)C2CCCCC2)C=C1 |
| InChI | InChI=1S/C13H20O3S/c1-11-7-9-13(14,10-8-11)17(15,16)12-5-3-2-4-6-12/h7-9,12,14H,2-6,10H2,1H3 |
| InChIKey | MEWBNSNKBSQDML-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-cyclohexylsulfonyl-4-methylcyclohexa-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexylsulfonyl-4-methylcyclohexa-2,4-dien-1-ol?
The IUPAC name of 1-cyclohexylsulfonyl-4-methylcyclohexa-2,4-dien-1-ol (CID 176894654) is 1-cyclohexylsulfonyl-4-methylcyclohexa-2,4-dien-1-ol.
What is the SMILES notation for 1-cyclohexylsulfonyl-4-methylcyclohexa-2,4-dien-1-ol?
The canonical SMILES for 1-cyclohexylsulfonyl-4-methylcyclohexa-2,4-dien-1-ol is CC1=CCC(O)(S(=O)(=O)C2CCCCC2)C=C1.
What is the InChIKey of 1-cyclohexylsulfonyl-4-methylcyclohexa-2,4-dien-1-ol?
The InChIKey is MEWBNSNKBSQDML-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O3S/c1-11-7-9-13(14,10-8-11)17(15,16)12-5-3-2-4-6-12/h7-9,12,14H,2-6,10H2,1H3.
What are the key properties of 1-cyclohexylsulfonyl-4-methylcyclohexa-2,4-dien-1-ol?
1-cyclohexylsulfonyl-4-methylcyclohexa-2,4-dien-1-ol has a molecular weight of 256.37 g/mol, XLogP of 2.33, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexylsulfonyl-4-methylcyclohexa-2,4-dien-1-ol is sourced from PubChem (CID 176894654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).