C10H18O3 — CID 101264945
(1S,3S,4R,5R)-4,6,6-trimethylbicyclo[3.1.1]heptane-1,3,4-triol (PubChem CID 101264945) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is (1S,3S,4R,5R)-4,6,6-trimethylbicyclo[3.1.1]heptane-1,3,4-triol.
| Compound Name | (1S,3S,4R,5R)-4,6,6-trimethylbicyclo[3.1.1]heptane-1,3,4-triol |
|---|---|
| PubChem CID | 101264945 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | (1S,3S,4R,5R)-4,6,6-trimethylbicyclo[3.1.1]heptane-1,3,4-triol |
| SMILES | CC1(C)[C@H]2C[C@]1(O)C[C@H](O)[C@]2(C)O |
| InChI | InChI=1S/C10H18O3/c1-8(2)6-4-10(8,13)5-7(11)9(6,3)12/h6-7,11-13H,4-5H2,1-3H3/t6-,7+,9-,10+/m1/s1 |
| InChIKey | CLWVCZCCLFGIKZ-KDDQHCCQSA-N |
| XLogP | 0.28 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |