C11H21O2U- — CID 149178506
carbanide;2,6,6-trimethylbicyclo[3.1.1]heptane-2,3-diol;uranium (PubChem CID 149178506) has the molecular formula C11H21O2U- and a molecular weight of 423.32 g/mol. Its IUPAC name is carbanide;2,6,6-trimethylbicyclo[3.1.1]heptane-2,3-diol;uranium.
| Compound Name | carbanide;2,6,6-trimethylbicyclo[3.1.1]heptane-2,3-diol;uranium |
|---|---|
| PubChem CID | 149178506 |
| Molecular Formula | C11H21O2U- |
| Molecular Weight | 423.32 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | carbanide;2,6,6-trimethylbicyclo[3.1.1]heptane-2,3-diol;uranium |
| SMILES | CC1(C)C2CC(O)C(C)(O)C1C2.[CH3-].[U] |
| InChI | InChI=1S/C10H18O2.CH3.U/c1-9(2)6-4-7(9)10(3,12)8(11)5-6;;/h6-8,11-12H,4-5H2,1-3H3;1H3;/q;-1; |
| InChIKey | MBMIJNJHALCCHA-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.32 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|