C10H17O4S- — CID 89391682
(2-hydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl) sulfite (PubChem CID 89391682) has the molecular formula C10H17O4S- and a molecular weight of 233.31 g/mol. Its IUPAC name is (2-hydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl) sulfite.
| Compound Name | (2-hydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl) sulfite |
|---|---|
| PubChem CID | 89391682 |
| Molecular Formula | C10H17O4S- |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | (2-hydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl) sulfite |
| SMILES | CC1(C)C2CC(OS(=O)[O-])C(C)(O)C1C2 |
| InChI | InChI=1S/C10H18O4S/c1-9(2)6-4-7(9)10(3,11)8(5-6)14-15(12)13/h6-8,11H,4-5H2,1-3H3,(H,12,13)/p-1 |
| InChIKey | UBAOYEUMQZMARM-UHFFFAOYSA-M |
| XLogP | 0.98 |
| TPSA | 69.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|