C17H32O2 — CID 174086615
(3R,3aR,5S,6R,7R)-7-ethyl-3,3a,6,8,8-pentamethyl-2,3,4,5,7,8a-hexahydro-1H-azulene-5,6-diol (PubChem CID 174086615) has the molecular formula C17H32O2 and a molecular weight of 268.44 g/mol. Its IUPAC name is (3R,3aR,5S,6R,7R)-7-ethyl-3,3a,6,8,8-pentamethyl-2,3,4,5,7,8a-hexahydro-1H-azulene-5,6-diol.
| Compound Name | (3R,3aR,5S,6R,7R)-7-ethyl-3,3a,6,8,8-pentamethyl-2,3,4,5,7,8a-hexahydro-1H-azulene-5,6-diol |
|---|---|
| PubChem CID | 174086615 |
| Molecular Formula | C17H32O2 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.24 |
| IUPAC Name | (3R,3aR,5S,6R,7R)-7-ethyl-3,3a,6,8,8-pentamethyl-2,3,4,5,7,8a-hexahydro-1H-azulene-5,6-diol |
| SMILES | CC[C@@H]1C(C)(C)C2CC[C@@H](C)[C@@]2(C)C[C@H](O)[C@]1(C)O |
| InChI | InChI=1S/C17H32O2/c1-7-12-15(3,4)13-9-8-11(2)16(13,5)10-14(18)17(12,6)19/h11-14,18-19H,7-10H2,1-6H3/t11-,12-,13?,14+,16-,17-/m1/s1 |
| InChIKey | ONBNTPMCEZENGZ-WEMOXKBPSA-N |
| XLogP | 3.61 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |