C16H30O2 — CID 155483870
(3R,3aR,5S,6R)-3a-ethyl-3,6,8,8-tetramethyl-2,3,4,5,7,8a-hexahydro-1H-azulene-5,6-diol (PubChem CID 155483870) has the molecular formula C16H30O2 and a molecular weight of 254.41 g/mol. Its IUPAC name is (3R,3aR,5S,6R)-3a-ethyl-3,6,8,8-tetramethyl-2,3,4,5,7,8a-hexahydro-1H-azulene-5,6-diol.
| Compound Name | (3R,3aR,5S,6R)-3a-ethyl-3,6,8,8-tetramethyl-2,3,4,5,7,8a-hexahydro-1H-azulene-5,6-diol |
|---|---|
| PubChem CID | 155483870 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | (3R,3aR,5S,6R)-3a-ethyl-3,6,8,8-tetramethyl-2,3,4,5,7,8a-hexahydro-1H-azulene-5,6-diol |
| SMILES | CC[C@]12C[C@H](O)[C@](C)(O)CC(C)(C)C1CC[C@H]2C |
| InChI | InChI=1S/C16H30O2/c1-6-16-9-13(17)15(5,18)10-14(3,4)12(16)8-7-11(16)2/h11-13,17-18H,6-10H2,1-5H3/t11-,12?,13+,15-,16-/m1/s1 |
| InChIKey | IDOLJDIRJMZYNB-BDTMOPOKSA-N |
| XLogP | 3.36 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |