About trans-(2S,4R)-4-ethyl-1,1,2,4-tetramethylcyclopentane
trans-(2S,4R)-4-ethyl-1,1,2,4-tetramethylcyclopentane (PubChem CID 163416827) has the molecular formula C11H22
and a molecular weight of 154.30 g/mol. Its IUPAC name is trans-(2S,4R)-4-ethyl-1,1,2,4-tetramethylcyclopentane.
Analyze trans-(2S,4R)-4-ethyl-1,1,2,4-tetramethylcyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(2S,4R)-4-ethyl-1,1,2,4-tetramethylcyclopentane?
The IUPAC name of trans-(2S,4R)-4-ethyl-1,1,2,4-tetramethylcyclopentane (CID 163416827) is trans-(2S,4R)-4-ethyl-1,1,2,4-tetramethylcyclopentane.
What is the SMILES notation for trans-(2S,4R)-4-ethyl-1,1,2,4-tetramethylcyclopentane?
The canonical SMILES for trans-(2S,4R)-4-ethyl-1,1,2,4-tetramethylcyclopentane is CC[C@]1(C)C[C@H](C)C(C)(C)C1.
What is the InChIKey of trans-(2S,4R)-4-ethyl-1,1,2,4-tetramethylcyclopentane?
The InChIKey is AFCQQVCOCXDLPY-GXSJLCMTSA-N. The full InChI is InChI=1S/C11H22/c1-6-11(5)7-9(2)10(3,4)8-11/h9H,6-8H2,1-5H3/t9-,11+/m0/s1.
What are the key properties of trans-(2S,4R)-4-ethyl-1,1,2,4-tetramethylcyclopentane?
trans-(2S,4R)-4-ethyl-1,1,2,4-tetramethylcyclopentane has a molecular weight of 154.30 g/mol, XLogP of 3.86, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(2S,4R)-4-ethyl-1,1,2,4-tetramethylcyclopentane is sourced from PubChem (CID 163416827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).