C22H44 — CID 91011571
2,6,9-triethyl-1,1,4,4,6,9-hexamethylcyclodecane (PubChem CID 91011571) has the molecular formula C22H44 and a molecular weight of 308.59 g/mol. Its IUPAC name is 2,6,9-triethyl-1,1,4,4,6,9-hexamethylcyclodecane.
| Compound Name | 2,6,9-triethyl-1,1,4,4,6,9-hexamethylcyclodecane |
|---|---|
| PubChem CID | 91011571 |
| Molecular Formula | C22H44 |
| Molecular Weight | 308.59 g/mol |
| Exact Mass | 308.34 |
| IUPAC Name | 2,6,9-triethyl-1,1,4,4,6,9-hexamethylcyclodecane |
| SMILES | CCC1CC(C)(C)CC(C)(CC)CCC(C)(CC)CC1(C)C |
| InChI | InChI=1S/C22H44/c1-10-18-15-19(4,5)16-21(8,11-2)13-14-22(9,12-3)17-20(18,6)7/h18H,10-17H2,1-9H3 |
| InChIKey | YKOBZMHGOSWVAY-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.59 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |