About 1,1-dimethylcyclopropane;1-ethyl-1-methylcyclopropane
1,1-dimethylcyclopropane;1-ethyl-1-methylcyclopropane (PubChem CID 143562468) has the molecular formula C11H22
and a molecular weight of 154.30 g/mol. Its IUPAC name is 1,1-dimethylcyclopropane;1-ethyl-1-methylcyclopropane.
Analyze 1,1-dimethylcyclopropane;1-ethyl-1-methylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethylcyclopropane;1-ethyl-1-methylcyclopropane?
The IUPAC name of 1,1-dimethylcyclopropane;1-ethyl-1-methylcyclopropane (CID 143562468) is 1,1-dimethylcyclopropane;1-ethyl-1-methylcyclopropane.
What is the SMILES notation for 1,1-dimethylcyclopropane;1-ethyl-1-methylcyclopropane?
The canonical SMILES for 1,1-dimethylcyclopropane;1-ethyl-1-methylcyclopropane is CC1(C)CC1.CCC1(C)CC1.
What is the InChIKey of 1,1-dimethylcyclopropane;1-ethyl-1-methylcyclopropane?
The InChIKey is NZHBOLKJUXXWOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12.C5H10/c1-3-6(2)4-5-6;1-5(2)3-4-5/h3-5H2,1-2H3;3-4H2,1-2H3.
What are the key properties of 1,1-dimethylcyclopropane;1-ethyl-1-methylcyclopropane?
1,1-dimethylcyclopropane;1-ethyl-1-methylcyclopropane has a molecular weight of 154.30 g/mol, XLogP of 4.00, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethylcyclopropane;1-ethyl-1-methylcyclopropane is sourced from PubChem (CID 143562468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).