1-ethyl-1-methylcyclohexane;molecular hydrogen

C9H20 — CID 143091347

IUPAC1-ethyl-1-methylcyclohexane;molecular hydrogen
SMILESCCC1(C)CCCCC1.[H][H]
InChIInChI=1S/C9H18.H2/c1-3-9(2)7-5-4-6-8-9;/h3-8H2,1-2H3;1H
InChIKeyRNYZCEOHMZTELM-UHFFFAOYSA-N
MW128.26 g/mol
LogP3.61
Rot. Bonds1

About 1-ethyl-1-methylcyclohexane;molecular hydrogen

1-ethyl-1-methylcyclohexane;molecular hydrogen (PubChem CID 143091347) has the molecular formula C9H20 and a molecular weight of 128.26 g/mol. Its IUPAC name is 1-ethyl-1-methylcyclohexane;molecular hydrogen.

Molecular Properties

Compound Name1-ethyl-1-methylcyclohexane;molecular hydrogen
PubChem CID143091347
Molecular FormulaC9H20
Molecular Weight128.26 g/mol
Exact Mass128.16
IUPAC Name1-ethyl-1-methylcyclohexane;molecular hydrogen
SMILESCCC1(C)CCCCC1.[H][H]
InChIInChI=1S/C9H18.H2/c1-3-9(2)7-5-4-6-8-9;/h3-8H2,1-2H3;1H
InChIKeyRNYZCEOHMZTELM-UHFFFAOYSA-N
XLogP3.61
TPSA0.00 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds1
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500128.26
LogP ≤ 53.61
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Analyze 1-ethyl-1-methylcyclohexane;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-ethyl-1-methylcyclohexane;molecular hydrogen?
The IUPAC name of 1-ethyl-1-methylcyclohexane;molecular hydrogen (CID 143091347) is 1-ethyl-1-methylcyclohexane;molecular hydrogen.
What is the SMILES notation for 1-ethyl-1-methylcyclohexane;molecular hydrogen?
The canonical SMILES for 1-ethyl-1-methylcyclohexane;molecular hydrogen is CCC1(C)CCCCC1.[H][H].
What is the InChIKey of 1-ethyl-1-methylcyclohexane;molecular hydrogen?
The InChIKey is RNYZCEOHMZTELM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18.H2/c1-3-9(2)7-5-4-6-8-9;/h3-8H2,1-2H3;1H.
What are the key properties of 1-ethyl-1-methylcyclohexane;molecular hydrogen?
1-ethyl-1-methylcyclohexane;molecular hydrogen has a molecular weight of 128.26 g/mol, XLogP of 3.61, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-1-methylcyclohexane;molecular hydrogen is sourced from PubChem (CID 143091347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).