About 1-ethyl-1,6-dimethyl-6-(3-methylbutyl)cycloundecane
1-ethyl-1,6-dimethyl-6-(3-methylbutyl)cycloundecane (PubChem CID 91393597) has the molecular formula C20H40
and a molecular weight of 280.54 g/mol. Its IUPAC name is 1-ethyl-1,6-dimethyl-6-(3-methylbutyl)cycloundecane.
Analyze 1-ethyl-1,6-dimethyl-6-(3-methylbutyl)cycloundecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-1,6-dimethyl-6-(3-methylbutyl)cycloundecane?
The IUPAC name of 1-ethyl-1,6-dimethyl-6-(3-methylbutyl)cycloundecane (CID 91393597) is 1-ethyl-1,6-dimethyl-6-(3-methylbutyl)cycloundecane.
What is the SMILES notation for 1-ethyl-1,6-dimethyl-6-(3-methylbutyl)cycloundecane?
The canonical SMILES for 1-ethyl-1,6-dimethyl-6-(3-methylbutyl)cycloundecane is CCC1(C)CCCCCC(C)(CCC(C)C)CCCC1.
What is the InChIKey of 1-ethyl-1,6-dimethyl-6-(3-methylbutyl)cycloundecane?
The InChIKey is HQGUDHBRZLYDDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H40/c1-6-19(4)13-8-7-9-15-20(5,16-11-10-14-19)17-12-18(2)3/h18H,6-17H2,1-5H3.
What are the key properties of 1-ethyl-1,6-dimethyl-6-(3-methylbutyl)cycloundecane?
1-ethyl-1,6-dimethyl-6-(3-methylbutyl)cycloundecane has a molecular weight of 280.54 g/mol, XLogP of 7.37, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-1,6-dimethyl-6-(3-methylbutyl)cycloundecane is sourced from PubChem (CID 91393597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).