About ethane;1-methoxybutane;1-methyl-1-(3-methylbutyl)cyclobutane
ethane;1-methoxybutane;1-methyl-1-(3-methylbutyl)cyclobutane (PubChem CID 144764405) has the molecular formula C17H38O
and a molecular weight of 258.49 g/mol. Its IUPAC name is ethane;1-methoxybutane;1-methyl-1-(3-methylbutyl)cyclobutane.
Molecular Properties
| Compound Name | ethane;1-methoxybutane;1-methyl-1-(3-methylbutyl)cyclobutane |
| PubChem CID | 144764405 |
| Molecular Formula | C17H38O |
| Molecular Weight | 258.49 g/mol |
| Exact Mass | 258.29 |
| IUPAC Name | ethane;1-methoxybutane;1-methyl-1-(3-methylbutyl)cyclobutane |
| SMILES | CC.CC(C)CCC1(C)CCC1.CCCCOC |
| InChI | InChI=1S/C10H20.C5H12O.C2H6/c1-9(2)5-8-10(3)6-4-7-10;1-3-4-5-6-2;1-2/h9H,4-8H2,1-3H3;3-5H2,1-2H3;1-2H3 |
| InChIKey | JWVZFNBICDERGD-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 258.49 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-methoxybutane;1-methyl-1-(3-methylbutyl)cyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methoxybutane;1-methyl-1-(3-methylbutyl)cyclobutane?
The IUPAC name of ethane;1-methoxybutane;1-methyl-1-(3-methylbutyl)cyclobutane (CID 144764405) is ethane;1-methoxybutane;1-methyl-1-(3-methylbutyl)cyclobutane.
What is the SMILES notation for ethane;1-methoxybutane;1-methyl-1-(3-methylbutyl)cyclobutane?
The canonical SMILES for ethane;1-methoxybutane;1-methyl-1-(3-methylbutyl)cyclobutane is CC.CC(C)CCC1(C)CCC1.CCCCOC.
What is the InChIKey of ethane;1-methoxybutane;1-methyl-1-(3-methylbutyl)cyclobutane?
The InChIKey is JWVZFNBICDERGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20.C5H12O.C2H6/c1-9(2)5-8-10(3)6-4-7-10;1-3-4-5-6-2;1-2/h9H,4-8H2,1-3H3;3-5H2,1-2H3;1-2H3.
What are the key properties of ethane;1-methoxybutane;1-methyl-1-(3-methylbutyl)cyclobutane?
ethane;1-methoxybutane;1-methyl-1-(3-methylbutyl)cyclobutane has a molecular weight of 258.49 g/mol, XLogP of 6.07, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methoxybutane;1-methyl-1-(3-methylbutyl)cyclobutane is sourced from PubChem (CID 144764405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).