About ethane;2-methylpropane;1-methyl-1-propylcyclopropane
ethane;2-methylpropane;1-methyl-1-propylcyclopropane (PubChem CID 156713855) has the molecular formula C13H30
and a molecular weight of 186.38 g/mol. Its IUPAC name is ethane;2-methylpropane;1-methyl-1-propylcyclopropane.
Molecular Properties
| Compound Name | ethane;2-methylpropane;1-methyl-1-propylcyclopropane |
| PubChem CID | 156713855 |
| Molecular Formula | C13H30 |
| Molecular Weight | 186.38 g/mol |
| Exact Mass | 186.23 |
| IUPAC Name | ethane;2-methylpropane;1-methyl-1-propylcyclopropane |
| SMILES | CC.CC(C)C.CCCC1(C)CC1 |
| InChI | InChI=1S/C7H14.C4H10.C2H6/c1-3-4-7(2)5-6-7;1-4(2)3;1-2/h3-6H2,1-2H3;4H,1-3H3;1-2H3 |
| InChIKey | KOBSMXKIUSQLPB-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 186.38 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;2-methylpropane;1-methyl-1-propylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylpropane;1-methyl-1-propylcyclopropane?
The IUPAC name of ethane;2-methylpropane;1-methyl-1-propylcyclopropane (CID 156713855) is ethane;2-methylpropane;1-methyl-1-propylcyclopropane.
What is the SMILES notation for ethane;2-methylpropane;1-methyl-1-propylcyclopropane?
The canonical SMILES for ethane;2-methylpropane;1-methyl-1-propylcyclopropane is CC.CC(C)C.CCCC1(C)CC1.
What is the InChIKey of ethane;2-methylpropane;1-methyl-1-propylcyclopropane?
The InChIKey is KOBSMXKIUSQLPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14.C4H10.C2H6/c1-3-4-7(2)5-6-7;1-4(2)3;1-2/h3-6H2,1-2H3;4H,1-3H3;1-2H3.
What are the key properties of ethane;2-methylpropane;1-methyl-1-propylcyclopropane?
ethane;2-methylpropane;1-methyl-1-propylcyclopropane has a molecular weight of 186.38 g/mol, XLogP of 5.28, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylpropane;1-methyl-1-propylcyclopropane is sourced from PubChem (CID 156713855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).