About 1-propan-2-yl-4,4-dipropylpiperidine
1-propan-2-yl-4,4-dipropylpiperidine (PubChem CID 89468851) has the molecular formula C14H29N
and a molecular weight of 211.39 g/mol. Its IUPAC name is 1-propan-2-yl-4,4-dipropylpiperidine.
Molecular Properties
| Compound Name | 1-propan-2-yl-4,4-dipropylpiperidine |
| PubChem CID | 89468851 |
| Molecular Formula | C14H29N |
| Molecular Weight | 211.39 g/mol |
| Exact Mass | 211.23 |
| IUPAC Name | 1-propan-2-yl-4,4-dipropylpiperidine |
| SMILES | CCCC1(CCC)CCN(C(C)C)CC1 |
| InChI | InChI=1S/C14H29N/c1-5-7-14(8-6-2)9-11-15(12-10-14)13(3)4/h13H,5-12H2,1-4H3 |
| InChIKey | WNPKPWWGEAPKHQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-propan-2-yl-4,4-dipropylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propan-2-yl-4,4-dipropylpiperidine?
The IUPAC name of 1-propan-2-yl-4,4-dipropylpiperidine (CID 89468851) is 1-propan-2-yl-4,4-dipropylpiperidine.
What is the SMILES notation for 1-propan-2-yl-4,4-dipropylpiperidine?
The canonical SMILES for 1-propan-2-yl-4,4-dipropylpiperidine is CCCC1(CCC)CCN(C(C)C)CC1.
What is the InChIKey of 1-propan-2-yl-4,4-dipropylpiperidine?
The InChIKey is WNPKPWWGEAPKHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29N/c1-5-7-14(8-6-2)9-11-15(12-10-14)13(3)4/h13H,5-12H2,1-4H3.
What are the key properties of 1-propan-2-yl-4,4-dipropylpiperidine?
1-propan-2-yl-4,4-dipropylpiperidine has a molecular weight of 211.39 g/mol, XLogP of 4.08, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propan-2-yl-4,4-dipropylpiperidine is sourced from PubChem (CID 89468851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).