C20H40N2 — CID 174291983
4-[(3-butyl-3-propylpyrrolidin-1-yl)methyl]-1-propan-2-ylpiperidine (PubChem CID 174291983) has the molecular formula C20H40N2 and a molecular weight of 308.55 g/mol. Its IUPAC name is 4-[(3-butyl-3-propylpyrrolidin-1-yl)methyl]-1-propan-2-ylpiperidine.
| Compound Name | 4-[(3-butyl-3-propylpyrrolidin-1-yl)methyl]-1-propan-2-ylpiperidine |
|---|---|
| PubChem CID | 174291983 |
| Molecular Formula | C20H40N2 |
| Molecular Weight | 308.55 g/mol |
| Exact Mass | 308.32 |
| IUPAC Name | 4-[(3-butyl-3-propylpyrrolidin-1-yl)methyl]-1-propan-2-ylpiperidine |
| SMILES | CCCCC1(CCC)CCN(CC2CCN(C(C)C)CC2)C1 |
| InChI | InChI=1S/C20H40N2/c1-5-7-11-20(10-6-2)12-15-21(17-20)16-19-8-13-22(14-9-19)18(3)4/h18-19H,5-17H2,1-4H3 |
| InChIKey | SRHDJHYTEMNPDQ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.55 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |