C19H37N3 — CID 174275638
1-propan-2-yl-4-[[(3S)-1-[(1-propylcyclopropyl)methyl]pyrrolidin-3-yl]methyl]piperazine (PubChem CID 174275638) has the molecular formula C19H37N3 and a molecular weight of 307.53 g/mol. Its IUPAC name is 1-propan-2-yl-4-[[(3S)-1-[(1-propylcyclopropyl)methyl]pyrrolidin-3-yl]methyl]piperazine.
| Compound Name | 1-propan-2-yl-4-[[(3S)-1-[(1-propylcyclopropyl)methyl]pyrrolidin-3-yl]methyl]piperazine |
|---|---|
| PubChem CID | 174275638 |
| Molecular Formula | C19H37N3 |
| Molecular Weight | 307.53 g/mol |
| Exact Mass | 307.30 |
| IUPAC Name | 1-propan-2-yl-4-[[(3S)-1-[(1-propylcyclopropyl)methyl]pyrrolidin-3-yl]methyl]piperazine |
| SMILES | CCCC1(CN2CC[C@H](CN3CCN(C(C)C)CC3)C2)CC1 |
| InChI | InChI=1S/C19H37N3/c1-4-6-19(7-8-19)16-21-9-5-18(15-21)14-20-10-12-22(13-11-20)17(2)3/h17-18H,4-16H2,1-3H3/t18-/m1/s1 |
| InChIKey | VGUOMCIQBYCVBK-GOSISDBHSA-N |
| XLogP | 2.91 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.53 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |